C19H22NO3Rf- — CID 89244514
[3-carboxy-4-hydroxy-6-(4-phenylphenyl)hexyl]azanide;rutherfordium (PubChem CID 89244514) has the molecular formula C19H22NO3Rf- and a molecular weight of 579.39 g/mol. Its IUPAC name is [3-carboxy-4-hydroxy-6-(4-phenylphenyl)hexyl]azanide;rutherfordium.
| Compound Name | [3-carboxy-4-hydroxy-6-(4-phenylphenyl)hexyl]azanide;rutherfordium |
|---|---|
| PubChem CID | 89244514 |
| Molecular Formula | C19H22NO3Rf- |
| Molecular Weight | 579.39 g/mol |
| Exact Mass | 579.28 |
| IUPAC Name | [3-carboxy-4-hydroxy-6-(4-phenylphenyl)hexyl]azanide;rutherfordium |
| SMILES | [NH-]CCC(C(=O)O)C(O)CCc1ccc(-c2ccccc2)cc1.[Rf] |
| InChI | InChI=1S/C19H22NO3.Rf/c20-13-12-17(19(22)23)18(21)11-8-14-6-9-16(10-7-14)15-4-2-1-3-5-15;/h1-7,9-10,17-18,20-21H,8,11-13H2,(H,22,23);/q-1; |
| InChIKey | BHTZWGVFKMGQAG-UHFFFAOYSA-N |
| XLogP | 3.79 |
| TPSA | 81.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 579.39 |
| LogP ≤ 5 | 3.79 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |