C27H27NO6 — CID 88961361
2-[2-[(2-formylbenzoyl)amino]ethyl]-3-hydroxy-5-[4-(4-hydroxyphenyl)phenyl]pentanoic acid (PubChem CID 88961361) has the molecular formula C27H27NO6 and a molecular weight of 461.51 g/mol. Its IUPAC name is 2-[2-[(2-formylbenzoyl)amino]ethyl]-3-hydroxy-5-[4-(4-hydroxyphenyl)phenyl]pentanoic acid.
| Compound Name | 2-[2-[(2-formylbenzoyl)amino]ethyl]-3-hydroxy-5-[4-(4-hydroxyphenyl)phenyl]pentanoic acid |
|---|---|
| PubChem CID | 88961361 |
| Molecular Formula | C27H27NO6 |
| Molecular Weight | 461.51 g/mol |
| Exact Mass | 461.18 |
| IUPAC Name | 2-[2-[(2-formylbenzoyl)amino]ethyl]-3-hydroxy-5-[4-(4-hydroxyphenyl)phenyl]pentanoic acid |
| SMILES | O=Cc1ccccc1C(=O)NCCC(C(=O)O)C(O)CCc1ccc(-c2ccc(O)cc2)cc1 |
| InChI | InChI=1S/C27H27NO6/c29-17-21-3-1-2-4-23(21)26(32)28-16-15-24(27(33)34)25(31)14-7-18-5-8-19(9-6-18)20-10-12-22(30)13-11-20/h1-6,8-13,17,24-25,30-31H,7,14-16H2,(H,28,32)(H,33,34) |
| InChIKey | WFBYSVBMJJOGRJ-UHFFFAOYSA-N |
| XLogP | 3.69 |
| TPSA | 123.93 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 461.51 |
| LogP ≤ 5 | 3.69 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|