C23H22N2O5 — CID 15984990
(2S)-2-(benzylamino)-5-[[4-(furan-2-yl)benzoyl]amino]-5-oxopentanoic acid (PubChem CID 15984990) has the molecular formula C23H22N2O5 and a molecular weight of 406.44 g/mol. Its IUPAC name is (2S)-2-(benzylamino)-5-[[4-(furan-2-yl)benzoyl]amino]-5-oxopentanoic acid.
| Compound Name | (2S)-2-(benzylamino)-5-[[4-(furan-2-yl)benzoyl]amino]-5-oxopentanoic acid |
|---|---|
| PubChem CID | 15984990 |
| Molecular Formula | C23H22N2O5 |
| Molecular Weight | 406.44 g/mol |
| Exact Mass | 406.15 |
| IUPAC Name | (2S)-2-(benzylamino)-5-[[4-(furan-2-yl)benzoyl]amino]-5-oxopentanoic acid |
| SMILES | O=C(CC[C@H](NCc1ccccc1)C(=O)O)NC(=O)c1ccc(-c2ccco2)cc1 |
| InChI | InChI=1S/C23H22N2O5/c26-21(13-12-19(23(28)29)24-15-16-5-2-1-3-6-16)25-22(27)18-10-8-17(9-11-18)20-7-4-14-30-20/h1-11,14,19,24H,12-13,15H2,(H,28,29)(H,25,26,27)/t19-/m0/s1 |
| InChIKey | FRTDWNCQARJZST-IBGZPJMESA-N |
| XLogP | 3.23 |
| TPSA | 108.64 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.44 |
| LogP ≤ 5 | 3.23 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |