C23H20N2O7 — CID 67333637
2-[[4-[4-(furan-2-carbonylamino)phenyl]benzoyl]amino]pentanedioic acid (PubChem CID 67333637) has the molecular formula C23H20N2O7 and a molecular weight of 436.42 g/mol. Its IUPAC name is 2-[[4-[4-(furan-2-carbonylamino)phenyl]benzoyl]amino]pentanedioic acid.
| Compound Name | 2-[[4-[4-(furan-2-carbonylamino)phenyl]benzoyl]amino]pentanedioic acid |
|---|---|
| PubChem CID | 67333637 |
| Molecular Formula | C23H20N2O7 |
| Molecular Weight | 436.42 g/mol |
| Exact Mass | 436.13 |
| IUPAC Name | 2-[[4-[4-(furan-2-carbonylamino)phenyl]benzoyl]amino]pentanedioic acid |
| SMILES | O=C(O)CCC(NC(=O)c1ccc(-c2ccc(NC(=O)c3ccco3)cc2)cc1)C(=O)O |
| InChI | InChI=1S/C23H20N2O7/c26-20(27)12-11-18(23(30)31)25-21(28)16-5-3-14(4-6-16)15-7-9-17(10-8-15)24-22(29)19-2-1-13-32-19/h1-10,13,18H,11-12H2,(H,24,29)(H,25,28)(H,26,27)(H,30,31) |
| InChIKey | MZZDQXYPSSCINI-UHFFFAOYSA-N |
| XLogP | 3.25 |
| TPSA | 145.94 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 436.42 |
| LogP ≤ 5 | 3.25 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |