C22H38O2Si — CID 15984228
(4aR,4bR,10aR)-9-[tert-butyl(dimethyl)silyl]oxy-4a,4b-dimethyl-2,3,5,6,7,8,10,10a-octahydro-1H-phenanthren-4-one (PubChem CID 15984228) has the molecular formula C22H38O2Si and a molecular weight of 362.63 g/mol. Its IUPAC name is (4aR,4bR,10aR)-9-[tert-butyl(dimethyl)silyl]oxy-4a,4b-dimethyl-2,3,5,6,7,8,10,10a-octahydro-1H-phenanthren-4-one.
| Compound Name | (4aR,4bR,10aR)-9-[tert-butyl(dimethyl)silyl]oxy-4a,4b-dimethyl-2,3,5,6,7,8,10,10a-octahydro-1H-phenanthren-4-one |
|---|---|
| PubChem CID | 15984228 |
| Molecular Formula | C22H38O2Si |
| Molecular Weight | 362.63 g/mol |
| Exact Mass | 362.26 |
| IUPAC Name | (4aR,4bR,10aR)-9-[tert-butyl(dimethyl)silyl]oxy-4a,4b-dimethyl-2,3,5,6,7,8,10,10a-octahydro-1H-phenanthren-4-one |
| SMILES | CC(C)(C)[Si](C)(C)OC1=C2CCCC[C@@]2(C)[C@]2(C)C(=O)CCC[C@@H]2C1 |
| InChI | InChI=1S/C22H38O2Si/c1-20(2,3)25(6,7)24-18-15-16-11-10-13-19(23)22(16,5)21(4)14-9-8-12-17(18)21/h16H,8-15H2,1-7H3/t16-,21-,22+/m1/s1 |
| InChIKey | DHPHFZZFIVHTAE-HVETUWLQSA-N |
| XLogP | 6.62 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.63 |
| LogP ≤ 5 | 6.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|