C14H18O7S — CID 159843392
2-[3-oxo-3-(2,4,6-trimethylphenoxy)propanoyl]oxyethanesulfonic acid (PubChem CID 159843392) has the molecular formula C14H18O7S and a molecular weight of 330.36 g/mol. Its IUPAC name is 2-[3-oxo-3-(2,4,6-trimethylphenoxy)propanoyl]oxyethanesulfonic acid.
| Compound Name | 2-[3-oxo-3-(2,4,6-trimethylphenoxy)propanoyl]oxyethanesulfonic acid |
|---|---|
| PubChem CID | 159843392 |
| Molecular Formula | C14H18O7S |
| Molecular Weight | 330.36 g/mol |
| Exact Mass | 330.08 |
| IUPAC Name | 2-[3-oxo-3-(2,4,6-trimethylphenoxy)propanoyl]oxyethanesulfonic acid |
| SMILES | Cc1cc(C)c(OC(=O)CC(=O)OCCS(=O)(=O)O)c(C)c1 |
| InChI | InChI=1S/C14H18O7S/c1-9-6-10(2)14(11(3)7-9)21-13(16)8-12(15)20-4-5-22(17,18)19/h6-7H,4-5,8H2,1-3H3,(H,17,18,19) |
| InChIKey | ATQGPFODXAWRCJ-UHFFFAOYSA-N |
| XLogP | 1.34 |
| TPSA | 106.97 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.36 |
| LogP ≤ 5 | 1.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|