C21H19N5O — CID 159853229
1-[3-[7-(5-methyl-1H-isoindol-4-yl)-3H-imidazo[4,5-c]pyridin-2-yl]azetidin-1-yl]prop-2-en-1-one (PubChem CID 159853229) has the molecular formula C21H19N5O and a molecular weight of 357.42 g/mol. Its IUPAC name is 1-[3-[7-(5-methyl-1H-isoindol-4-yl)-3H-imidazo[4,5-c]pyridin-2-yl]azetidin-1-yl]prop-2-en-1-one.
| Compound Name | 1-[3-[7-(5-methyl-1H-isoindol-4-yl)-3H-imidazo[4,5-c]pyridin-2-yl]azetidin-1-yl]prop-2-en-1-one |
|---|---|
| PubChem CID | 159853229 |
| Molecular Formula | C21H19N5O |
| Molecular Weight | 357.42 g/mol |
| Exact Mass | 357.16 |
| IUPAC Name | 1-[3-[7-(5-methyl-1H-isoindol-4-yl)-3H-imidazo[4,5-c]pyridin-2-yl]azetidin-1-yl]prop-2-en-1-one |
| SMILES | C=CC(=O)N1CC(c2nc3c(-c4c(C)ccc5c4C=NC5)cncc3[nH]2)C1 |
| InChI | InChI=1S/C21H19N5O/c1-3-18(27)26-10-14(11-26)21-24-17-9-23-8-16(20(17)25-21)19-12(2)4-5-13-6-22-7-15(13)19/h3-5,7-9,14H,1,6,10-11H2,2H3,(H,24,25) |
| InChIKey | NQEZAAUSZMFKFY-UHFFFAOYSA-N |
| XLogP | 2.98 |
| TPSA | 74.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.42 |
| LogP ≤ 5 | 2.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|