C32H52N2O6 — CID 159869289
tert-butyl 2-[6-(aminomethyl)-3-ethyl-6-bicyclo[3.2.0]hept-3-enyl]acetate;tert-butyl 2-[3-ethyl-6-(nitromethyl)-6-bicyclo[3.2.0]hept-3-enyl]acetate (PubChem CID 159869289) has the molecular formula C32H52N2O6 and a molecular weight of 560.78 g/mol. Its IUPAC name is tert-butyl 2-[6-(aminomethyl)-3-ethyl-6-bicyclo[3.2.0]hept-3-enyl]acetate;tert-butyl 2-[3-ethyl-6-(nitromethyl)-6-bicyclo[3.2.0]hept-3-enyl]acetate.
| Compound Name | tert-butyl 2-[6-(aminomethyl)-3-ethyl-6-bicyclo[3.2.0]hept-3-enyl]acetate;tert-butyl 2-[3-ethyl-6-(nitromethyl)-6-bicyclo[3.2.0]hept-3-enyl]acetate |
|---|---|
| PubChem CID | 159869289 |
| Molecular Formula | C32H52N2O6 |
| Molecular Weight | 560.78 g/mol |
| Exact Mass | 560.38 |
| IUPAC Name | tert-butyl 2-[6-(aminomethyl)-3-ethyl-6-bicyclo[3.2.0]hept-3-enyl]acetate;tert-butyl 2-[3-ethyl-6-(nitromethyl)-6-bicyclo[3.2.0]hept-3-enyl]acetate |
| SMILES | CCC1=CC2C(C1)CC2(CC(=O)OC(C)(C)C)C[N+](=O)[O-].CCC1=CC2C(C1)CC2(CN)CC(=O)OC(C)(C)C |
| InChI | InChI=1S/C16H25NO4.C16H27NO2/c1-5-11-6-12-8-16(10-17(19)20,13(12)7-11)9-14(18)21-15(2,3)4;1-5-11-6-12-8-16(10-17,13(12)7-11)9-14(18)19-15(2,3)4/h7,12-13H,5-6,8-10H2,1-4H3;7,12-13H,5-6,8-10,17H2,1-4H3 |
| InChIKey | NSDAMFAXCLWUIT-UHFFFAOYSA-N |
| XLogP | 6.40 |
| TPSA | 121.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 560.78 |
| LogP ≤ 5 | 6.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|