C21H38O3 — CID 159873481
ethene;1,1,1-tris(prop-1-en-2-yloxy)decane (PubChem CID 159873481) has the molecular formula C21H38O3 and a molecular weight of 338.53 g/mol. Its IUPAC name is ethene;1,1,1-tris(prop-1-en-2-yloxy)decane.
| Compound Name | ethene;1,1,1-tris(prop-1-en-2-yloxy)decane |
|---|---|
| PubChem CID | 159873481 |
| Molecular Formula | C21H38O3 |
| Molecular Weight | 338.53 g/mol |
| Exact Mass | 338.28 |
| IUPAC Name | ethene;1,1,1-tris(prop-1-en-2-yloxy)decane |
| SMILES | C=C.C=C(C)OC(CCCCCCCCC)(OC(=C)C)OC(=C)C |
| InChI | InChI=1S/C19H34O3.C2H4/c1-8-9-10-11-12-13-14-15-19(20-16(2)3,21-17(4)5)22-18(6)7;1-2/h2,4,6,8-15H2,1,3,5,7H3;1-2H2 |
| InChIKey | NSPJIIRFMLUYCQ-UHFFFAOYSA-N |
| XLogP | 7.23 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.53 |
| LogP ≤ 5 | 7.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|