C23H25NO4PS+ — CID 159874401
2-[hydroxy(3-methylsulfanylpropoxy)phosphoryl]oxyethyl-trimethylazanium;tetradeca-1,3,5,7,9,11,13-heptayne (PubChem CID 159874401) has the molecular formula C23H25NO4PS+ and a molecular weight of 442.50 g/mol. Its IUPAC name is 2-[hydroxy(3-methylsulfanylpropoxy)phosphoryl]oxyethyl-trimethylazanium;tetradeca-1,3,5,7,9,11,13-heptayne.
| Compound Name | 2-[hydroxy(3-methylsulfanylpropoxy)phosphoryl]oxyethyl-trimethylazanium;tetradeca-1,3,5,7,9,11,13-heptayne |
|---|---|
| PubChem CID | 159874401 |
| Molecular Formula | C23H25NO4PS+ |
| Molecular Weight | 442.50 g/mol |
| Exact Mass | 442.12 |
| IUPAC Name | 2-[hydroxy(3-methylsulfanylpropoxy)phosphoryl]oxyethyl-trimethylazanium;tetradeca-1,3,5,7,9,11,13-heptayne |
| SMILES | C#CC#CC#CC#CC#CC#CC#C.CSCCCOP(=O)(O)OCC[N+](C)(C)C |
| InChI | InChI=1S/C14H2.C9H22NO4PS/c1-3-5-7-9-11-13-14-12-10-8-6-4-2;1-10(2,3)6-8-14-15(11,12)13-7-5-9-16-4/h1-2H;5-9H2,1-4H3/p+1 |
| InChIKey | JQUMJZOUGGBNEX-UHFFFAOYSA-O |
| XLogP | 1.85 |
| TPSA | 55.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 442.50 |
| LogP ≤ 5 | 1.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|