C32H41NO8PS+ — CID 59409846
2-[[3-dodeca-1,3,5,7,9,11-hexaynylsulfanyl-2-[8-(3-oxobutanoyloxy)octoxy]propoxy]-hydroxyphosphoryl]oxyethyl-trimethylazanium (PubChem CID 59409846) has the molecular formula C32H41NO8PS+ and a molecular weight of 630.72 g/mol. Its IUPAC name is 2-[[3-dodeca-1,3,5,7,9,11-hexaynylsulfanyl-2-[8-(3-oxobutanoyloxy)octoxy]propoxy]-hydroxyphosphoryl]oxyethyl-trimethylazanium.
| Compound Name | 2-[[3-dodeca-1,3,5,7,9,11-hexaynylsulfanyl-2-[8-(3-oxobutanoyloxy)octoxy]propoxy]-hydroxyphosphoryl]oxyethyl-trimethylazanium |
|---|---|
| PubChem CID | 59409846 |
| Molecular Formula | C32H41NO8PS+ |
| Molecular Weight | 630.72 g/mol |
| Exact Mass | 630.23 |
| IUPAC Name | 2-[[3-dodeca-1,3,5,7,9,11-hexaynylsulfanyl-2-[8-(3-oxobutanoyloxy)octoxy]propoxy]-hydroxyphosphoryl]oxyethyl-trimethylazanium |
| SMILES | C#CC#CC#CC#CC#CC#CSCC(COP(=O)(O)OCC[N+](C)(C)C)OCCCCCCCCOC(=O)CC(C)=O |
| InChI | InChI=1S/C32H40NO8PS/c1-6-7-8-9-10-11-12-15-18-21-26-43-29-31(28-41-42(36,37)40-25-22-33(3,4)5)38-23-19-16-13-14-17-20-24-39-32(35)27-30(2)34/h1,31H,13-14,16-17,19-20,22-25,27-29H2,2-5H3/p+1 |
| InChIKey | VFYBSGSHSTZKIM-UHFFFAOYSA-O |
| XLogP | 3.42 |
| TPSA | 108.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 21 |
| Heavy Atoms | 43 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 630.72 |
| LogP ≤ 5 | 3.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|