C14H10F2INO3 — CID 159875518
5-fluoro-2-[(2-fluoro-4-iodophenyl)methyl]-1-methyl-6-oxopyridine-3-carboxylic acid (PubChem CID 159875518) has the molecular formula C14H10F2INO3 and a molecular weight of 405.14 g/mol. Its IUPAC name is 5-fluoro-2-[(2-fluoro-4-iodophenyl)methyl]-1-methyl-6-oxopyridine-3-carboxylic acid.
| Compound Name | 5-fluoro-2-[(2-fluoro-4-iodophenyl)methyl]-1-methyl-6-oxopyridine-3-carboxylic acid |
|---|---|
| PubChem CID | 159875518 |
| Molecular Formula | C14H10F2INO3 |
| Molecular Weight | 405.14 g/mol |
| Exact Mass | 404.97 |
| IUPAC Name | 5-fluoro-2-[(2-fluoro-4-iodophenyl)methyl]-1-methyl-6-oxopyridine-3-carboxylic acid |
| SMILES | Cn1c(Cc2ccc(I)cc2F)c(C(=O)O)cc(F)c1=O |
| InChI | InChI=1S/C14H10F2INO3/c1-18-12(4-7-2-3-8(17)5-10(7)15)9(14(20)21)6-11(16)13(18)19/h2-3,5-6H,4H2,1H3,(H,20,21) |
| InChIKey | NSVXAOKQVUFAPZ-UHFFFAOYSA-N |
| XLogP | 2.56 |
| TPSA | 59.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 405.14 |
| LogP ≤ 5 | 2.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|