C15H14FIN2O2 — CID 58368320
2-[(2-fluoro-4-iodophenyl)methyl]-1,5-dimethyl-6-oxopyridine-3-carboxamide (PubChem CID 58368320) has the molecular formula C15H14FIN2O2 and a molecular weight of 400.19 g/mol. Its IUPAC name is 2-[(2-fluoro-4-iodophenyl)methyl]-1,5-dimethyl-6-oxopyridine-3-carboxamide.
| Compound Name | 2-[(2-fluoro-4-iodophenyl)methyl]-1,5-dimethyl-6-oxopyridine-3-carboxamide |
|---|---|
| PubChem CID | 58368320 |
| Molecular Formula | C15H14FIN2O2 |
| Molecular Weight | 400.19 g/mol |
| Exact Mass | 400.01 |
| IUPAC Name | 2-[(2-fluoro-4-iodophenyl)methyl]-1,5-dimethyl-6-oxopyridine-3-carboxamide |
| SMILES | Cc1cc(C(N)=O)c(Cc2ccc(I)cc2F)n(C)c1=O |
| InChI | InChI=1S/C15H14FIN2O2/c1-8-5-11(14(18)20)13(19(2)15(8)21)6-9-3-4-10(17)7-12(9)16/h3-5,7H,6H2,1-2H3,(H2,18,20) |
| InChIKey | VCSTZYRCSGMMNN-UHFFFAOYSA-N |
| XLogP | 2.13 |
| TPSA | 65.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.19 |
| LogP ≤ 5 | 2.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|