C19H30O4 — CID 159876089
(4Z)-cyclooct-4-ene-1-carboxylic acid;(4Z)-1-methylcyclooct-4-ene-1-carboxylic acid (PubChem CID 159876089) has the molecular formula C19H30O4 and a molecular weight of 322.45 g/mol. Its IUPAC name is (4Z)-cyclooct-4-ene-1-carboxylic acid;(4Z)-1-methylcyclooct-4-ene-1-carboxylic acid.
| Compound Name | (4Z)-cyclooct-4-ene-1-carboxylic acid;(4Z)-1-methylcyclooct-4-ene-1-carboxylic acid |
|---|---|
| PubChem CID | 159876089 |
| Molecular Formula | C19H30O4 |
| Molecular Weight | 322.45 g/mol |
| Exact Mass | 322.21 |
| IUPAC Name | (4Z)-cyclooct-4-ene-1-carboxylic acid;(4Z)-1-methylcyclooct-4-ene-1-carboxylic acid |
| SMILES | CC1(C(=O)O)CC/C=C\CCC1.O=C(O)C1CC/C=C\CCC1 |
| InChI | InChI=1S/C10H16O2.C9H14O2/c1-10(9(11)12)7-5-3-2-4-6-8-10;10-9(11)8-6-4-2-1-3-5-7-8/h2-3H,4-8H2,1H3,(H,11,12);1-2,8H,3-7H2,(H,10,11)/b3-2-;2-1- |
| InChIKey | NSXRANKSZAOCQP-FGRDZWBJSA-N |
| XLogP | 4.81 |
| TPSA | 74.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.45 |
| LogP ≤ 5 | 4.81 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|