C30H43O2P — CID 159876895
[(4-butyl-2,6-dimethylbenzoyl)-(2-methylpropyl)phosphanyl]-(4-butyl-2,6-dimethylphenyl)methanone (PubChem CID 159876895) has the molecular formula C30H43O2P and a molecular weight of 466.65 g/mol. Its IUPAC name is [(4-butyl-2,6-dimethylbenzoyl)-(2-methylpropyl)phosphanyl]-(4-butyl-2,6-dimethylphenyl)methanone.
| Compound Name | [(4-butyl-2,6-dimethylbenzoyl)-(2-methylpropyl)phosphanyl]-(4-butyl-2,6-dimethylphenyl)methanone |
|---|---|
| PubChem CID | 159876895 |
| Molecular Formula | C30H43O2P |
| Molecular Weight | 466.65 g/mol |
| Exact Mass | 466.30 |
| IUPAC Name | [(4-butyl-2,6-dimethylbenzoyl)-(2-methylpropyl)phosphanyl]-(4-butyl-2,6-dimethylphenyl)methanone |
| SMILES | CCCCc1cc(C)c(C(=O)P(CC(C)C)C(=O)c2c(C)cc(CCCC)cc2C)c(C)c1 |
| InChI | InChI=1S/C30H43O2P/c1-9-11-13-25-15-21(5)27(22(6)16-25)29(31)33(19-20(3)4)30(32)28-23(7)17-26(14-12-10-2)18-24(28)8/h15-18,20H,9-14,19H2,1-8H3 |
| InChIKey | YYWNWFNOQVLWHJ-UHFFFAOYSA-N |
| XLogP | 8.72 |
| TPSA | 34.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 466.65 |
| LogP ≤ 5 | 8.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|