C19H19F3N4O4S — CID 159878334
2-[3-[(5R)-3-amino-2,5-dimethyl-1,1-dioxo-6H-1,2,4-thiadiazin-5-yl]-2,4-difluorophenyl]-1-(3-fluoro-5-methoxy-2-pyridinyl)ethanone (PubChem CID 159878334) has the molecular formula C19H19F3N4O4S and a molecular weight of 456.45 g/mol. Its IUPAC name is 2-[3-[(5R)-3-amino-2,5-dimethyl-1,1-dioxo-6H-1,2,4-thiadiazin-5-yl]-2,4-difluorophenyl]-1-(3-fluoro-5-methoxy-2-pyridinyl)ethanone.
| Compound Name | 2-[3-[(5R)-3-amino-2,5-dimethyl-1,1-dioxo-6H-1,2,4-thiadiazin-5-yl]-2,4-difluorophenyl]-1-(3-fluoro-5-methoxy-2-pyridinyl)ethanone |
|---|---|
| PubChem CID | 159878334 |
| Molecular Formula | C19H19F3N4O4S |
| Molecular Weight | 456.45 g/mol |
| Exact Mass | 456.11 |
| IUPAC Name | 2-[3-[(5R)-3-amino-2,5-dimethyl-1,1-dioxo-6H-1,2,4-thiadiazin-5-yl]-2,4-difluorophenyl]-1-(3-fluoro-5-methoxy-2-pyridinyl)ethanone |
| SMILES | COc1cnc(C(=O)Cc2ccc(F)c([C@]3(C)CS(=O)(=O)N(C)C(N)=N3)c2F)c(F)c1 |
| InChI | InChI=1S/C19H19F3N4O4S/c1-19(9-31(28,29)26(2)18(23)25-19)15-12(20)5-4-10(16(15)22)6-14(27)17-13(21)7-11(30-3)8-24-17/h4-5,7-8H,6,9H2,1-3H3,(H2,23,25)/t19-/m0/s1 |
| InChIKey | ZSCCWNIGWHIAKE-IBGZPJMESA-N |
| XLogP | 1.74 |
| TPSA | 114.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 456.45 |
| LogP ≤ 5 | 1.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |