C15H31BO3 — CID 159879745
cyclopentane;2-(3-methoxypropyl)-4,4,5,5-tetramethyl-1,3,2-dioxaborolane (PubChem CID 159879745) has the molecular formula C15H31BO3 and a molecular weight of 270.22 g/mol. Its IUPAC name is cyclopentane;2-(3-methoxypropyl)-4,4,5,5-tetramethyl-1,3,2-dioxaborolane.
| Compound Name | cyclopentane;2-(3-methoxypropyl)-4,4,5,5-tetramethyl-1,3,2-dioxaborolane |
|---|---|
| PubChem CID | 159879745 |
| Molecular Formula | C15H31BO3 |
| Molecular Weight | 270.22 g/mol |
| Exact Mass | 270.24 |
| IUPAC Name | cyclopentane;2-(3-methoxypropyl)-4,4,5,5-tetramethyl-1,3,2-dioxaborolane |
| SMILES | C1CCCC1.COCCCB1OC(C)(C)C(C)(C)O1 |
| InChI | InChI=1S/C10H21BO3.C5H10/c1-9(2)10(3,4)14-11(13-9)7-6-8-12-5;1-2-4-5-3-1/h6-8H2,1-5H3;1-5H2 |
| InChIKey | NTJMNICMMYRFCE-UHFFFAOYSA-N |
| XLogP | 4.07 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 270.22 |
| LogP ≤ 5 | 4.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|