About bis(dihydroxy(oxo)phosphanium);2-pyridin-3-ylethenol
bis(dihydroxy(oxo)phosphanium);2-pyridin-3-ylethenol (PubChem CID 159880051) has the molecular formula C7H11NO7P2+2
and a molecular weight of 283.11 g/mol. Its IUPAC name is bis(dihydroxy(oxo)phosphanium);2-pyridin-3-ylethenol.
Molecular Properties
| Compound Name | bis(dihydroxy(oxo)phosphanium);2-pyridin-3-ylethenol |
| PubChem CID | 159880051 |
| Molecular Formula | C7H11NO7P2+2 |
| Molecular Weight | 283.11 g/mol |
| Exact Mass | 283.00 |
| IUPAC Name | bis(dihydroxy(oxo)phosphanium);2-pyridin-3-ylethenol |
| SMILES | O=[P+](O)O.O=[P+](O)O.OC=Cc1cccnc1 |
| InChI | InChI=1S/C7H7NO.2HO3P/c9-5-3-7-2-1-4-8-6-7;2*1-4(2)3/h1-6,9H;2*(H-,1,2,3)/p+2 |
| InChIKey | RLEMCCNPJIFXQD-UHFFFAOYSA-P |
| XLogP | 0.87 |
| TPSA | 148.18 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 283.11 |
| LogP ≤ 5 | 0.87 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|
Analyze bis(dihydroxy(oxo)phosphanium);2-pyridin-3-ylethenol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of bis(dihydroxy(oxo)phosphanium);2-pyridin-3-ylethenol?
The IUPAC name of bis(dihydroxy(oxo)phosphanium);2-pyridin-3-ylethenol (CID 159880051) is bis(dihydroxy(oxo)phosphanium);2-pyridin-3-ylethenol.
What is the SMILES notation for bis(dihydroxy(oxo)phosphanium);2-pyridin-3-ylethenol?
The canonical SMILES for bis(dihydroxy(oxo)phosphanium);2-pyridin-3-ylethenol is O=[P+](O)O.O=[P+](O)O.OC=Cc1cccnc1.
What is the InChIKey of bis(dihydroxy(oxo)phosphanium);2-pyridin-3-ylethenol?
The InChIKey is RLEMCCNPJIFXQD-UHFFFAOYSA-P. The full InChI is InChI=1S/C7H7NO.2HO3P/c9-5-3-7-2-1-4-8-6-7;2*1-4(2)3/h1-6,9H;2*(H-,1,2,3)/p+2.
What are the key properties of bis(dihydroxy(oxo)phosphanium);2-pyridin-3-ylethenol?
bis(dihydroxy(oxo)phosphanium);2-pyridin-3-ylethenol has a molecular weight of 283.11 g/mol, XLogP of 0.87, 1 rotatable bonds, 5 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for bis(dihydroxy(oxo)phosphanium);2-pyridin-3-ylethenol is sourced from PubChem (CID 159880051), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).