C26H31N5O3 — CID 159881607
6-(4-aminophenyl)-1-[(2R)-2-[[4-(phenoxymethyl)triazol-1-yl]methyl]pyrrolidin-1-yl]hexane-1,4-dione (PubChem CID 159881607) has the molecular formula C26H31N5O3 and a molecular weight of 461.57 g/mol. Its IUPAC name is 6-(4-aminophenyl)-1-[(2R)-2-[[4-(phenoxymethyl)triazol-1-yl]methyl]pyrrolidin-1-yl]hexane-1,4-dione.
| Compound Name | 6-(4-aminophenyl)-1-[(2R)-2-[[4-(phenoxymethyl)triazol-1-yl]methyl]pyrrolidin-1-yl]hexane-1,4-dione |
|---|---|
| PubChem CID | 159881607 |
| Molecular Formula | C26H31N5O3 |
| Molecular Weight | 461.57 g/mol |
| Exact Mass | 461.24 |
| IUPAC Name | 6-(4-aminophenyl)-1-[(2R)-2-[[4-(phenoxymethyl)triazol-1-yl]methyl]pyrrolidin-1-yl]hexane-1,4-dione |
| SMILES | Nc1ccc(CCC(=O)CCC(=O)N2CCC[C@@H]2Cn2cc(COc3ccccc3)nn2)cc1 |
| InChI | InChI=1S/C26H31N5O3/c27-21-11-8-20(9-12-21)10-13-24(32)14-15-26(33)31-16-4-5-23(31)18-30-17-22(28-29-30)19-34-25-6-2-1-3-7-25/h1-3,6-9,11-12,17,23H,4-5,10,13-16,18-19,27H2/t23-/m1/s1 |
| InChIKey | LXNIKRLRZWAPFC-HSZRJFAPSA-N |
| XLogP | 3.41 |
| TPSA | 103.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 461.57 |
| LogP ≤ 5 | 3.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'anil_no_alk(40)', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|