C25H29N5O3 — CID 171144142
N-benzyl-1-[[1-[2-(4-ethoxyphenyl)acetyl]pyrrolidin-2-yl]methyl]triazole-4-carboxamide (PubChem CID 171144142) has the molecular formula C25H29N5O3 and a molecular weight of 447.54 g/mol. Its IUPAC name is N-benzyl-1-[[1-[2-(4-ethoxyphenyl)acetyl]pyrrolidin-2-yl]methyl]triazole-4-carboxamide.
| Compound Name | N-benzyl-1-[[1-[2-(4-ethoxyphenyl)acetyl]pyrrolidin-2-yl]methyl]triazole-4-carboxamide |
|---|---|
| PubChem CID | 171144142 |
| Molecular Formula | C25H29N5O3 |
| Molecular Weight | 447.54 g/mol |
| Exact Mass | 447.23 |
| IUPAC Name | N-benzyl-1-[[1-[2-(4-ethoxyphenyl)acetyl]pyrrolidin-2-yl]methyl]triazole-4-carboxamide |
| SMILES | CCOc1ccc(CC(=O)N2CCCC2Cn2cc(C(=O)NCc3ccccc3)nn2)cc1 |
| InChI | InChI=1S/C25H29N5O3/c1-2-33-22-12-10-19(11-13-22)15-24(31)30-14-6-9-21(30)17-29-18-23(27-28-29)25(32)26-16-20-7-4-3-5-8-20/h3-5,7-8,10-13,18,21H,2,6,9,14-17H2,1H3,(H,26,32) |
| InChIKey | KQMCKFFTIZDAAL-UHFFFAOYSA-N |
| XLogP | 2.84 |
| TPSA | 89.35 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 447.54 |
| LogP ≤ 5 | 2.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |