C20H23N5OS — CID 171144048
N-benzyl-1-[[1-(thiophen-3-ylmethyl)pyrrolidin-2-yl]methyl]triazole-4-carboxamide (PubChem CID 171144048) has the molecular formula C20H23N5OS and a molecular weight of 381.51 g/mol. Its IUPAC name is N-benzyl-1-[[1-(thiophen-3-ylmethyl)pyrrolidin-2-yl]methyl]triazole-4-carboxamide.
| Compound Name | N-benzyl-1-[[1-(thiophen-3-ylmethyl)pyrrolidin-2-yl]methyl]triazole-4-carboxamide |
|---|---|
| PubChem CID | 171144048 |
| Molecular Formula | C20H23N5OS |
| Molecular Weight | 381.51 g/mol |
| Exact Mass | 381.16 |
| IUPAC Name | N-benzyl-1-[[1-(thiophen-3-ylmethyl)pyrrolidin-2-yl]methyl]triazole-4-carboxamide |
| SMILES | O=C(NCc1ccccc1)c1cn(CC2CCCN2Cc2ccsc2)nn1 |
| InChI | InChI=1S/C20H23N5OS/c26-20(21-11-16-5-2-1-3-6-16)19-14-25(23-22-19)13-18-7-4-9-24(18)12-17-8-10-27-15-17/h1-3,5-6,8,10,14-15,18H,4,7,9,11-13H2,(H,21,26) |
| InChIKey | FORMJKGLVJHHEM-UHFFFAOYSA-N |
| XLogP | 2.93 |
| TPSA | 63.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.51 |
| LogP ≤ 5 | 2.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |