C20H26N6O2 — CID 171141392
1-[[1-(1H-indol-3-ylmethyl)pyrrolidin-2-yl]methyl]-N-(2-methoxyethyl)triazole-4-carboxamide (PubChem CID 171141392) has the molecular formula C20H26N6O2 and a molecular weight of 382.47 g/mol. Its IUPAC name is 1-[[1-(1H-indol-3-ylmethyl)pyrrolidin-2-yl]methyl]-N-(2-methoxyethyl)triazole-4-carboxamide.
| Compound Name | 1-[[1-(1H-indol-3-ylmethyl)pyrrolidin-2-yl]methyl]-N-(2-methoxyethyl)triazole-4-carboxamide |
|---|---|
| PubChem CID | 171141392 |
| Molecular Formula | C20H26N6O2 |
| Molecular Weight | 382.47 g/mol |
| Exact Mass | 382.21 |
| IUPAC Name | 1-[[1-(1H-indol-3-ylmethyl)pyrrolidin-2-yl]methyl]-N-(2-methoxyethyl)triazole-4-carboxamide |
| SMILES | COCCNC(=O)c1cn(CC2CCCN2Cc2c[nH]c3ccccc23)nn1 |
| InChI | InChI=1S/C20H26N6O2/c1-28-10-8-21-20(27)19-14-26(24-23-19)13-16-5-4-9-25(16)12-15-11-22-18-7-3-2-6-17(15)18/h2-3,6-7,11,14,16,22H,4-5,8-10,12-13H2,1H3,(H,21,27) |
| InChIKey | YZCOKUPSUJSBRA-UHFFFAOYSA-N |
| XLogP | 1.80 |
| TPSA | 88.07 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.47 |
| LogP ≤ 5 | 1.80 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|