C19H23ClFN5O3 — CID 171145006
1-[[1-[2-(2-chlorophenyl)acetyl]-4-fluoropyrrolidin-2-yl]methyl]-N-(2-methoxyethyl)triazole-4-carboxamide (PubChem CID 171145006) has the molecular formula C19H23ClFN5O3 and a molecular weight of 423.88 g/mol. Its IUPAC name is 1-[[1-[2-(2-chlorophenyl)acetyl]-4-fluoropyrrolidin-2-yl]methyl]-N-(2-methoxyethyl)triazole-4-carboxamide.
| Compound Name | 1-[[1-[2-(2-chlorophenyl)acetyl]-4-fluoropyrrolidin-2-yl]methyl]-N-(2-methoxyethyl)triazole-4-carboxamide |
|---|---|
| PubChem CID | 171145006 |
| Molecular Formula | C19H23ClFN5O3 |
| Molecular Weight | 423.88 g/mol |
| Exact Mass | 423.15 |
| IUPAC Name | 1-[[1-[2-(2-chlorophenyl)acetyl]-4-fluoropyrrolidin-2-yl]methyl]-N-(2-methoxyethyl)triazole-4-carboxamide |
| SMILES | COCCNC(=O)c1cn(CC2CC(F)CN2C(=O)Cc2ccccc2Cl)nn1 |
| InChI | InChI=1S/C19H23ClFN5O3/c1-29-7-6-22-19(28)17-12-25(24-23-17)11-15-9-14(21)10-26(15)18(27)8-13-4-2-3-5-16(13)20/h2-5,12,14-15H,6-11H2,1H3,(H,22,28) |
| InChIKey | QQWNQLCDRCXDME-UHFFFAOYSA-N |
| XLogP | 1.49 |
| TPSA | 89.35 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 423.88 |
| LogP ≤ 5 | 1.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|