C17H28FN5O3 — CID 171145004
1-[[4-fluoro-1-(4-methylpentanoyl)pyrrolidin-2-yl]methyl]-N-(2-methoxyethyl)triazole-4-carboxamide (PubChem CID 171145004) has the molecular formula C17H28FN5O3 and a molecular weight of 369.44 g/mol. Its IUPAC name is 1-[[4-fluoro-1-(4-methylpentanoyl)pyrrolidin-2-yl]methyl]-N-(2-methoxyethyl)triazole-4-carboxamide.
| Compound Name | 1-[[4-fluoro-1-(4-methylpentanoyl)pyrrolidin-2-yl]methyl]-N-(2-methoxyethyl)triazole-4-carboxamide |
|---|---|
| PubChem CID | 171145004 |
| Molecular Formula | C17H28FN5O3 |
| Molecular Weight | 369.44 g/mol |
| Exact Mass | 369.22 |
| IUPAC Name | 1-[[4-fluoro-1-(4-methylpentanoyl)pyrrolidin-2-yl]methyl]-N-(2-methoxyethyl)triazole-4-carboxamide |
| SMILES | COCCNC(=O)c1cn(CC2CC(F)CN2C(=O)CCC(C)C)nn1 |
| InChI | InChI=1S/C17H28FN5O3/c1-12(2)4-5-16(24)23-9-13(18)8-14(23)10-22-11-15(20-21-22)17(25)19-6-7-26-3/h11-14H,4-10H2,1-3H3,(H,19,25) |
| InChIKey | MTGKNPPVOFCYBG-UHFFFAOYSA-N |
| XLogP | 1.03 |
| TPSA | 89.35 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.44 |
| LogP ≤ 5 | 1.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|