C22H24ClN5O — CID 171144124
N-benzyl-1-[[1-[(3-chlorophenyl)methyl]pyrrolidin-2-yl]methyl]triazole-4-carboxamide (PubChem CID 171144124) has the molecular formula C22H24ClN5O and a molecular weight of 409.92 g/mol. Its IUPAC name is N-benzyl-1-[[1-[(3-chlorophenyl)methyl]pyrrolidin-2-yl]methyl]triazole-4-carboxamide.
| Compound Name | N-benzyl-1-[[1-[(3-chlorophenyl)methyl]pyrrolidin-2-yl]methyl]triazole-4-carboxamide |
|---|---|
| PubChem CID | 171144124 |
| Molecular Formula | C22H24ClN5O |
| Molecular Weight | 409.92 g/mol |
| Exact Mass | 409.17 |
| IUPAC Name | N-benzyl-1-[[1-[(3-chlorophenyl)methyl]pyrrolidin-2-yl]methyl]triazole-4-carboxamide |
| SMILES | O=C(NCc1ccccc1)c1cn(CC2CCCN2Cc2cccc(Cl)c2)nn1 |
| InChI | InChI=1S/C22H24ClN5O/c23-19-9-4-8-18(12-19)14-27-11-5-10-20(27)15-28-16-21(25-26-28)22(29)24-13-17-6-2-1-3-7-17/h1-4,6-9,12,16,20H,5,10-11,13-15H2,(H,24,29) |
| InChIKey | MMTICOUJIVVHDE-UHFFFAOYSA-N |
| XLogP | 3.53 |
| TPSA | 63.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 409.92 |
| LogP ≤ 5 | 3.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |