C24H27N5O3 — CID 171141330
N-benzyl-1-[[1-(2-ethoxybenzoyl)pyrrolidin-2-yl]methyl]triazole-4-carboxamide (PubChem CID 171141330) has the molecular formula C24H27N5O3 and a molecular weight of 433.51 g/mol. Its IUPAC name is N-benzyl-1-[[1-(2-ethoxybenzoyl)pyrrolidin-2-yl]methyl]triazole-4-carboxamide.
| Compound Name | N-benzyl-1-[[1-(2-ethoxybenzoyl)pyrrolidin-2-yl]methyl]triazole-4-carboxamide |
|---|---|
| PubChem CID | 171141330 |
| Molecular Formula | C24H27N5O3 |
| Molecular Weight | 433.51 g/mol |
| Exact Mass | 433.21 |
| IUPAC Name | N-benzyl-1-[[1-(2-ethoxybenzoyl)pyrrolidin-2-yl]methyl]triazole-4-carboxamide |
| SMILES | CCOc1ccccc1C(=O)N1CCCC1Cn1cc(C(=O)NCc2ccccc2)nn1 |
| InChI | InChI=1S/C24H27N5O3/c1-2-32-22-13-7-6-12-20(22)24(31)29-14-8-11-19(29)16-28-17-21(26-27-28)23(30)25-15-18-9-4-3-5-10-18/h3-7,9-10,12-13,17,19H,2,8,11,14-16H2,1H3,(H,25,30) |
| InChIKey | AVATXVKMVXJLMU-UHFFFAOYSA-N |
| XLogP | 2.91 |
| TPSA | 89.35 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 433.51 |
| LogP ≤ 5 | 2.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |