C22H21F2N5O2 — CID 171144126
N-benzyl-1-[[1-(3,4-difluorobenzoyl)pyrrolidin-2-yl]methyl]triazole-4-carboxamide (PubChem CID 171144126) has the molecular formula C22H21F2N5O2 and a molecular weight of 425.44 g/mol. Its IUPAC name is N-benzyl-1-[[1-(3,4-difluorobenzoyl)pyrrolidin-2-yl]methyl]triazole-4-carboxamide.
| Compound Name | N-benzyl-1-[[1-(3,4-difluorobenzoyl)pyrrolidin-2-yl]methyl]triazole-4-carboxamide |
|---|---|
| PubChem CID | 171144126 |
| Molecular Formula | C22H21F2N5O2 |
| Molecular Weight | 425.44 g/mol |
| Exact Mass | 425.17 |
| IUPAC Name | N-benzyl-1-[[1-(3,4-difluorobenzoyl)pyrrolidin-2-yl]methyl]triazole-4-carboxamide |
| SMILES | O=C(NCc1ccccc1)c1cn(CC2CCCN2C(=O)c2ccc(F)c(F)c2)nn1 |
| InChI | InChI=1S/C22H21F2N5O2/c23-18-9-8-16(11-19(18)24)22(31)29-10-4-7-17(29)13-28-14-20(26-27-28)21(30)25-12-15-5-2-1-3-6-15/h1-3,5-6,8-9,11,14,17H,4,7,10,12-13H2,(H,25,30) |
| InChIKey | FTKMRNOHTQWROD-UHFFFAOYSA-N |
| XLogP | 2.79 |
| TPSA | 80.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 425.44 |
| LogP ≤ 5 | 2.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |