C17H20BN5O5 — CID 166432503
[2-formyl-4-[2-[[4-(methylcarbamoyl)triazol-1-yl]methyl]pyrrolidine-1-carbonyl]phenyl]boronic acid (PubChem CID 166432503) has the molecular formula C17H20BN5O5 and a molecular weight of 385.19 g/mol. Its IUPAC name is [2-formyl-4-[2-[[4-(methylcarbamoyl)triazol-1-yl]methyl]pyrrolidine-1-carbonyl]phenyl]boronic acid.
| Compound Name | [2-formyl-4-[2-[[4-(methylcarbamoyl)triazol-1-yl]methyl]pyrrolidine-1-carbonyl]phenyl]boronic acid |
|---|---|
| PubChem CID | 166432503 |
| Molecular Formula | C17H20BN5O5 |
| Molecular Weight | 385.19 g/mol |
| Exact Mass | 385.16 |
| IUPAC Name | [2-formyl-4-[2-[[4-(methylcarbamoyl)triazol-1-yl]methyl]pyrrolidine-1-carbonyl]phenyl]boronic acid |
| SMILES | CNC(=O)c1cn(CC2CCCN2C(=O)c2ccc(B(O)O)c(C=O)c2)nn1 |
| InChI | InChI=1S/C17H20BN5O5/c1-19-16(25)15-9-22(21-20-15)8-13-3-2-6-23(13)17(26)11-4-5-14(18(27)28)12(7-11)10-24/h4-5,7,9-10,13,27-28H,2-3,6,8H2,1H3,(H,19,25) |
| InChIKey | XFIWBOMULRGYQD-UHFFFAOYSA-N |
| XLogP | -1.57 |
| TPSA | 137.65 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.19 |
| LogP ≤ 5 | -1.57 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|