C9H10N4O2 — CID 159883494
1H-imidazole;1,2-oxazole;1,3-oxazole (PubChem CID 159883494) has the molecular formula C9H10N4O2 and a molecular weight of 206.21 g/mol. Its IUPAC name is 1H-imidazole;1,2-oxazole;1,3-oxazole.
| Compound Name | 1H-imidazole;1,2-oxazole;1,3-oxazole |
|---|---|
| PubChem CID | 159883494 |
| Molecular Formula | C9H10N4O2 |
| Molecular Weight | 206.21 g/mol |
| Exact Mass | 206.08 |
| IUPAC Name | 1H-imidazole;1,2-oxazole;1,3-oxazole |
| SMILES | c1c[nH]cn1.c1cnoc1.c1cocn1 |
| InChI | InChI=1S/C3H4N2.2C3H3NO/c2*1-2-5-3-4-1;1-2-4-5-3-1/h1-3H,(H,4,5);2*1-3H |
| InChIKey | NTVIXMHLEMPITE-UHFFFAOYSA-N |
| XLogP | 1.76 |
| TPSA | 80.74 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 206.21 |
| LogP ≤ 5 | 1.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |