C40H44ClN3O5 — CID 159885017
9H-fluoren-9-ylmethyl (3R,5S)-3-amino-5-[[9-(3-ethoxypropyl)xanthen-9-yl]methylcarbamoyl]piperidine-1-carboxylate;hydrochloride (PubChem CID 159885017) has the molecular formula C40H44ClN3O5 and a molecular weight of 682.26 g/mol. Its IUPAC name is 9H-fluoren-9-ylmethyl (3R,5S)-3-amino-5-[[9-(3-ethoxypropyl)xanthen-9-yl]methylcarbamoyl]piperidine-1-carboxylate;hydrochloride.
| Compound Name | 9H-fluoren-9-ylmethyl (3R,5S)-3-amino-5-[[9-(3-ethoxypropyl)xanthen-9-yl]methylcarbamoyl]piperidine-1-carboxylate;hydrochloride |
|---|---|
| PubChem CID | 159885017 |
| Molecular Formula | C40H44ClN3O5 |
| Molecular Weight | 682.26 g/mol |
| Exact Mass | 681.30 |
| IUPAC Name | 9H-fluoren-9-ylmethyl (3R,5S)-3-amino-5-[[9-(3-ethoxypropyl)xanthen-9-yl]methylcarbamoyl]piperidine-1-carboxylate;hydrochloride |
| SMILES | CCOCCCC1(CNC(=O)[C@H]2C[C@@H](N)CN(C(=O)OCC3c4ccccc4-c4ccccc43)C2)c2ccccc2Oc2ccccc21.Cl |
| InChI | InChI=1S/C40H43N3O5.ClH/c1-2-46-21-11-20-40(34-16-7-9-18-36(34)48-37-19-10-8-17-35(37)40)26-42-38(44)27-22-28(41)24-43(23-27)39(45)47-25-33-31-14-5-3-12-29(31)30-13-4-6-15-32(30)33;/h3-10,12-19,27-28,33H,2,11,20-26,41H2,1H3,(H,42,44);1H/t27-,28+;/m0./s1 |
| InChIKey | BPHFNKCCUHMVRO-DUZWKJOOSA-N |
| XLogP | 7.03 |
| TPSA | 103.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 49 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 682.26 |
| LogP ≤ 5 | 7.03 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|