C14H22O8 — CID 159886272
(E)-4-[5-methoxy-1-(3-methoxypropoxy)-1-oxopentan-2-yl]oxy-4-oxobut-2-enoic acid (PubChem CID 159886272) has the molecular formula C14H22O8 and a molecular weight of 318.32 g/mol. Its IUPAC name is (E)-4-[5-methoxy-1-(3-methoxypropoxy)-1-oxopentan-2-yl]oxy-4-oxobut-2-enoic acid.
| Compound Name | (E)-4-[5-methoxy-1-(3-methoxypropoxy)-1-oxopentan-2-yl]oxy-4-oxobut-2-enoic acid |
|---|---|
| PubChem CID | 159886272 |
| Molecular Formula | C14H22O8 |
| Molecular Weight | 318.32 g/mol |
| Exact Mass | 318.13 |
| IUPAC Name | (E)-4-[5-methoxy-1-(3-methoxypropoxy)-1-oxopentan-2-yl]oxy-4-oxobut-2-enoic acid |
| SMILES | COCCCOC(=O)C(CCCOC)OC(=O)/C=C/C(=O)O |
| InChI | InChI=1S/C14H22O8/c1-19-8-3-5-11(14(18)21-10-4-9-20-2)22-13(17)7-6-12(15)16/h6-7,11H,3-5,8-10H2,1-2H3,(H,15,16)/b7-6+ |
| InChIKey | NUEHBVAPINJNDT-VOTSOKGWSA-N |
| XLogP | 0.55 |
| TPSA | 108.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.32 |
| LogP ≤ 5 | 0.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|