C8H19ClO8P2 — CID 159887147
butanoyl chloride;(1-hydroxy-1-phosphonobutyl)phosphonic acid (PubChem CID 159887147) has the molecular formula C8H19ClO8P2 and a molecular weight of 340.63 g/mol. Its IUPAC name is butanoyl chloride;(1-hydroxy-1-phosphonobutyl)phosphonic acid.
| Compound Name | butanoyl chloride;(1-hydroxy-1-phosphonobutyl)phosphonic acid |
|---|---|
| PubChem CID | 159887147 |
| Molecular Formula | C8H19ClO8P2 |
| Molecular Weight | 340.63 g/mol |
| Exact Mass | 340.02 |
| IUPAC Name | butanoyl chloride;(1-hydroxy-1-phosphonobutyl)phosphonic acid |
| SMILES | CCCC(=O)Cl.CCCC(O)(P(=O)(O)O)P(=O)(O)O |
| InChI | InChI=1S/C4H7ClO.C4H12O7P2/c1-2-3-4(5)6;1-2-3-4(5,12(6,7)8)13(9,10)11/h2-3H2,1H3;5H,2-3H2,1H3,(H2,6,7,8)(H2,9,10,11) |
| InChIKey | NUGYDJUJYDNDEP-UHFFFAOYSA-N |
| XLogP | 1.34 |
| TPSA | 152.36 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.63 |
| LogP ≤ 5 | 1.34 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'acid_halide', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|