About CID 159888747
CID 159888747 (PubChem CID 159888747) has the molecular formula C7H16B2O5P-
and a molecular weight of 232.80 g/mol.
Molecular Properties
| Compound Name | CID 159888747 |
| PubChem CID | 159888747 |
| Molecular Formula | C7H16B2O5P- |
| Molecular Weight | 232.80 g/mol |
| Exact Mass | 233.09 |
| IUPAC Name | — |
| SMILES | [B][C@@H]1O[C@H](COC)C(OP([BH3-])(C)=O)[C@@H]1O |
| InChI | InChI=1S/C7H16B2O5P/c1-12-3-4-6(14-15(2,9)11)5(10)7(8)13-4/h4-7,10H,3H2,1-2,9H3/q-1/t4-,5+,6?,7-,15?/m1/s1 |
| InChIKey | IAVXPDVYOWDZRG-XHZCUKGBSA-N |
| XLogP | -1.54 |
| TPSA | 64.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 232.80 |
| LogP ≤ 5 | -1.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|
Analyze CID 159888747 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 159888747?
The IUPAC name of CID 159888747 (CID 159888747) is not available.
What is the SMILES notation for CID 159888747?
The canonical SMILES for CID 159888747 is [B][C@@H]1O[C@H](COC)C(OP([BH3-])(C)=O)[C@@H]1O.
What is the InChIKey of CID 159888747?
The InChIKey is IAVXPDVYOWDZRG-XHZCUKGBSA-N. The full InChI is InChI=1S/C7H16B2O5P/c1-12-3-4-6(14-15(2,9)11)5(10)7(8)13-4/h4-7,10H,3H2,1-2,9H3/q-1/t4-,5+,6?,7-,15?/m1/s1.
What are the key properties of CID 159888747?
CID 159888747 has a molecular weight of 232.80 g/mol, XLogP of -1.54, 4 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for CID 159888747 is sourced from PubChem (CID 159888747), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).