C8H16BO7P — CID 88543139
CID 88543139 (PubChem CID 88543139) has the molecular formula C8H16BO7P and a molecular weight of 265.99 g/mol.
| Compound Name | CID 88543139 |
|---|---|
| PubChem CID | 88543139 |
| Molecular Formula | C8H16BO7P |
| Molecular Weight | 265.99 g/mol |
| Exact Mass | 266.07 |
| IUPAC Name | — |
| SMILES | [B][C@@H]1O[C@H](CO)C(OP(=O)(O)OCCC)C1O |
| InChI | InChI=1S/C8H16BO7P/c1-2-3-14-17(12,13)16-7-5(4-10)15-8(9)6(7)11/h5-8,10-11H,2-4H2,1H3,(H,12,13)/t5-,6?,7?,8-/m1/s1 |
| InChIKey | QSRHHMCRACVISR-LFHVAVFRSA-N |
| XLogP | -0.85 |
| TPSA | 105.45 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 265.99 |
| LogP ≤ 5 | -0.85 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|