C21H24FN5O2S — CID 159889034
4-(cyclohexylmethyl)-3-[2-(4-fluorophenyl)tetrazol-5-yl]-N-methylbenzenesulfonamide (PubChem CID 159889034) has the molecular formula C21H24FN5O2S and a molecular weight of 429.52 g/mol. Its IUPAC name is 4-(cyclohexylmethyl)-3-[2-(4-fluorophenyl)tetrazol-5-yl]-N-methylbenzenesulfonamide.
| Compound Name | 4-(cyclohexylmethyl)-3-[2-(4-fluorophenyl)tetrazol-5-yl]-N-methylbenzenesulfonamide |
|---|---|
| PubChem CID | 159889034 |
| Molecular Formula | C21H24FN5O2S |
| Molecular Weight | 429.52 g/mol |
| Exact Mass | 429.16 |
| IUPAC Name | 4-(cyclohexylmethyl)-3-[2-(4-fluorophenyl)tetrazol-5-yl]-N-methylbenzenesulfonamide |
| SMILES | CNS(=O)(=O)c1ccc(CC2CCCCC2)c(-c2nnn(-c3ccc(F)cc3)n2)c1 |
| InChI | InChI=1S/C21H24FN5O2S/c1-23-30(28,29)19-12-7-16(13-15-5-3-2-4-6-15)20(14-19)21-24-26-27(25-21)18-10-8-17(22)9-11-18/h7-12,14-15,23H,2-6,13H2,1H3 |
| InChIKey | NUMUPYGUAFBYPA-UHFFFAOYSA-N |
| XLogP | 3.50 |
| TPSA | 89.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 429.52 |
| LogP ≤ 5 | 3.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |