C17H24FN5O2S — CID 159428193
4-(cyclohexylmethyl)-3-[2-(2-fluoroethyl)tetrazol-5-yl]-N-methylbenzenesulfonamide (PubChem CID 159428193) has the molecular formula C17H24FN5O2S and a molecular weight of 381.48 g/mol. Its IUPAC name is 4-(cyclohexylmethyl)-3-[2-(2-fluoroethyl)tetrazol-5-yl]-N-methylbenzenesulfonamide.
| Compound Name | 4-(cyclohexylmethyl)-3-[2-(2-fluoroethyl)tetrazol-5-yl]-N-methylbenzenesulfonamide |
|---|---|
| PubChem CID | 159428193 |
| Molecular Formula | C17H24FN5O2S |
| Molecular Weight | 381.48 g/mol |
| Exact Mass | 381.16 |
| IUPAC Name | 4-(cyclohexylmethyl)-3-[2-(2-fluoroethyl)tetrazol-5-yl]-N-methylbenzenesulfonamide |
| SMILES | CNS(=O)(=O)c1ccc(CC2CCCCC2)c(-c2nnn(CCF)n2)c1 |
| InChI | InChI=1S/C17H24FN5O2S/c1-19-26(24,25)15-8-7-14(11-13-5-3-2-4-6-13)16(12-15)17-20-22-23(21-17)10-9-18/h7-8,12-13,19H,2-6,9-11H2,1H3 |
| InChIKey | LQQJYVUDKIEOJX-UHFFFAOYSA-N |
| XLogP | 2.34 |
| TPSA | 89.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.48 |
| LogP ≤ 5 | 2.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |