C32H39N3O7S — CID 159894638
3-[[6-[3-[4-(dimethylamino)butoxy]-5-propoxyphenoxy]-1,3-dimethyl-2-oxobenzimidazol-5-yl]methylsulfonyl]benzaldehyde (PubChem CID 159894638) has the molecular formula C32H39N3O7S and a molecular weight of 609.75 g/mol. Its IUPAC name is 3-[[6-[3-[4-(dimethylamino)butoxy]-5-propoxyphenoxy]-1,3-dimethyl-2-oxobenzimidazol-5-yl]methylsulfonyl]benzaldehyde.
| Compound Name | 3-[[6-[3-[4-(dimethylamino)butoxy]-5-propoxyphenoxy]-1,3-dimethyl-2-oxobenzimidazol-5-yl]methylsulfonyl]benzaldehyde |
|---|---|
| PubChem CID | 159894638 |
| Molecular Formula | C32H39N3O7S |
| Molecular Weight | 609.75 g/mol |
| Exact Mass | 609.25 |
| IUPAC Name | 3-[[6-[3-[4-(dimethylamino)butoxy]-5-propoxyphenoxy]-1,3-dimethyl-2-oxobenzimidazol-5-yl]methylsulfonyl]benzaldehyde |
| SMILES | CCCOc1cc(OCCCCN(C)C)cc(Oc2cc3c(cc2CS(=O)(=O)c2cccc(C=O)c2)n(C)c(=O)n3C)c1 |
| InChI | InChI=1S/C32H39N3O7S/c1-6-13-40-25-17-26(41-14-8-7-12-33(2)3)19-27(18-25)42-31-20-30-29(34(4)32(37)35(30)5)16-24(31)22-43(38,39)28-11-9-10-23(15-28)21-36/h9-11,15-21H,6-8,12-14,22H2,1-5H3 |
| InChIKey | GDWFLSJRWBHZJP-UHFFFAOYSA-N |
| XLogP | 4.97 |
| TPSA | 109.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 43 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 609.75 |
| LogP ≤ 5 | 4.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|