C19H25I2NO2 — CID 159895533
(1S)-14-methoxy-4,8,9-trimethyl-11-oxa-4-azatetracyclo[8.6.1.01,12.06,17]heptadeca-6(17),7,9,15-tetraene;molecular iodine (PubChem CID 159895533) has the molecular formula C19H25I2NO2 and a molecular weight of 553.22 g/mol. Its IUPAC name is (1S)-14-methoxy-4,8,9-trimethyl-11-oxa-4-azatetracyclo[8.6.1.01,12.06,17]heptadeca-6(17),7,9,15-tetraene;molecular iodine.
| Compound Name | (1S)-14-methoxy-4,8,9-trimethyl-11-oxa-4-azatetracyclo[8.6.1.01,12.06,17]heptadeca-6(17),7,9,15-tetraene;molecular iodine |
|---|---|
| PubChem CID | 159895533 |
| Molecular Formula | C19H25I2NO2 |
| Molecular Weight | 553.22 g/mol |
| Exact Mass | 553.00 |
| IUPAC Name | (1S)-14-methoxy-4,8,9-trimethyl-11-oxa-4-azatetracyclo[8.6.1.01,12.06,17]heptadeca-6(17),7,9,15-tetraene;molecular iodine |
| SMILES | COC1C=C[C@@]23CCN(C)Cc4cc(C)c(C)c(c42)OC3C1.II |
| InChI | InChI=1S/C19H25NO2.I2/c1-12-9-14-11-20(3)8-7-19-6-5-15(21-4)10-16(19)22-18(13(12)2)17(14)19;1-2/h5-6,9,15-16H,7-8,10-11H2,1-4H3;/t15?,16?,19-;/m0./s1 |
| InChIKey | NVHHJIBWNGXDKL-FHQPZZCOSA-N |
| XLogP | 4.88 |
| TPSA | 21.70 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 553.22 |
| LogP ≤ 5 | 4.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|