C13H14N8O2 — CID 159896045
N-(1-methylpyrazol-4-yl)-4-[(1-methylpyrazol-4-yl)methyl]-5-nitropyrimidin-2-amine (PubChem CID 159896045) has the molecular formula C13H14N8O2 and a molecular weight of 314.31 g/mol. Its IUPAC name is N-(1-methylpyrazol-4-yl)-4-[(1-methylpyrazol-4-yl)methyl]-5-nitropyrimidin-2-amine.
| Compound Name | N-(1-methylpyrazol-4-yl)-4-[(1-methylpyrazol-4-yl)methyl]-5-nitropyrimidin-2-amine |
|---|---|
| PubChem CID | 159896045 |
| Molecular Formula | C13H14N8O2 |
| Molecular Weight | 314.31 g/mol |
| Exact Mass | 314.12 |
| IUPAC Name | N-(1-methylpyrazol-4-yl)-4-[(1-methylpyrazol-4-yl)methyl]-5-nitropyrimidin-2-amine |
| SMILES | Cn1cc(Cc2nc(Nc3cnn(C)c3)ncc2[N+](=O)[O-])cn1 |
| InChI | InChI=1S/C13H14N8O2/c1-19-7-9(4-15-19)3-11-12(21(22)23)6-14-13(18-11)17-10-5-16-20(2)8-10/h4-8H,3H2,1-2H3,(H,14,17,18) |
| InChIKey | XYWCFTBPCNUQNQ-UHFFFAOYSA-N |
| XLogP | 1.19 |
| TPSA | 116.59 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.31 |
| LogP ≤ 5 | 1.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|