C37H34N2O7S — CID 159898341
2-[[4-[6-[4-[(4-methylphenyl)sulfanylamino]cyclohexyl]oxynaphthalen-2-yl]oxybenzoyl]amino]benzoic acid;molecular oxygen (PubChem CID 159898341) has the molecular formula C37H34N2O7S and a molecular weight of 650.75 g/mol. Its IUPAC name is 2-[[4-[6-[4-[(4-methylphenyl)sulfanylamino]cyclohexyl]oxynaphthalen-2-yl]oxybenzoyl]amino]benzoic acid;molecular oxygen.
| Compound Name | 2-[[4-[6-[4-[(4-methylphenyl)sulfanylamino]cyclohexyl]oxynaphthalen-2-yl]oxybenzoyl]amino]benzoic acid;molecular oxygen |
|---|---|
| PubChem CID | 159898341 |
| Molecular Formula | C37H34N2O7S |
| Molecular Weight | 650.75 g/mol |
| Exact Mass | 650.21 |
| IUPAC Name | 2-[[4-[6-[4-[(4-methylphenyl)sulfanylamino]cyclohexyl]oxynaphthalen-2-yl]oxybenzoyl]amino]benzoic acid;molecular oxygen |
| SMILES | Cc1ccc(SNC2CCC(Oc3ccc4cc(Oc5ccc(C(=O)Nc6ccccc6C(=O)O)cc5)ccc4c3)CC2)cc1.O=O |
| InChI | InChI=1S/C37H34N2O5S.O2/c1-24-6-20-33(21-7-24)45-39-28-12-18-30(19-13-28)44-32-17-11-26-22-31(16-10-27(26)23-32)43-29-14-8-25(9-15-29)36(40)38-35-5-3-2-4-34(35)37(41)42;1-2/h2-11,14-17,20-23,28,30,39H,12-13,18-19H2,1H3,(H,38,40)(H,41,42); |
| InChIKey | NVQFRYYJMVEZPW-UHFFFAOYSA-N |
| XLogP | 8.94 |
| TPSA | 131.03 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 650.75 |
| LogP ≤ 5 | 8.94 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|