About CID 159912603
CID 159912603 (PubChem CID 159912603) has the molecular formula C8H10B2NO4
and a molecular weight of 205.80 g/mol.
Molecular Properties
| Compound Name | CID 159912603 |
| PubChem CID | 159912603 |
| Molecular Formula | C8H10B2NO4 |
| Molecular Weight | 205.80 g/mol |
| Exact Mass | 206.08 |
| IUPAC Name | — |
| SMILES | OB(O)c1ccc2cc[nH]c2c1.O[B]O |
| InChI | InChI=1S/C8H8BNO2.BH2O2/c11-9(12)7-2-1-6-3-4-10-8(6)5-7;2-1-3/h1-5,10-12H;2-3H |
| InChIKey | GCRVXWLHJFEBJN-UHFFFAOYSA-N |
| XLogP | -1.65 |
| TPSA | 96.71 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 205.80 |
| LogP ≤ 5 | -1.65 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze CID 159912603 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 159912603?
The IUPAC name of CID 159912603 (CID 159912603) is not available.
What is the SMILES notation for CID 159912603?
The canonical SMILES for CID 159912603 is OB(O)c1ccc2cc[nH]c2c1.O[B]O.
What is the InChIKey of CID 159912603?
The InChIKey is GCRVXWLHJFEBJN-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H8BNO2.BH2O2/c11-9(12)7-2-1-6-3-4-10-8(6)5-7;2-1-3/h1-5,10-12H;2-3H.
What are the key properties of CID 159912603?
CID 159912603 has a molecular weight of 205.80 g/mol, XLogP of -1.65, 1 rotatable bonds, 5 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for CID 159912603 is sourced from PubChem (CID 159912603), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).