C28H32BClN2O2 — CID 161221557
3-chlorocyclohexene;6-cyclohex-2-en-1-yl-1H-indole;1H-indol-6-ylboronic acid (PubChem CID 161221557) has the molecular formula C28H32BClN2O2 and a molecular weight of 474.84 g/mol. Its IUPAC name is 3-chlorocyclohexene;6-cyclohex-2-en-1-yl-1H-indole;1H-indol-6-ylboronic acid.
| Compound Name | 3-chlorocyclohexene;6-cyclohex-2-en-1-yl-1H-indole;1H-indol-6-ylboronic acid |
|---|---|
| PubChem CID | 161221557 |
| Molecular Formula | C28H32BClN2O2 |
| Molecular Weight | 474.84 g/mol |
| Exact Mass | 474.22 |
| IUPAC Name | 3-chlorocyclohexene;6-cyclohex-2-en-1-yl-1H-indole;1H-indol-6-ylboronic acid |
| SMILES | C1=CC(c2ccc3cc[nH]c3c2)CCC1.ClC1C=CCCC1.OB(O)c1ccc2cc[nH]c2c1 |
| InChI | InChI=1S/C14H15N.C8H8BNO2.C6H9Cl/c1-2-4-11(5-3-1)13-7-6-12-8-9-15-14(12)10-13;11-9(12)7-2-1-6-3-4-10-8(6)5-7;7-6-4-2-1-3-5-6/h2,4,6-11,15H,1,3,5H2;1-5,10-12H;2,4,6H,1,3,5H2 |
| InChIKey | UXOQHQLAIORFOM-UHFFFAOYSA-N |
| XLogP | 6.17 |
| TPSA | 72.04 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 474.84 |
| LogP ≤ 5 | 6.17 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|