C16H18N2 — CID 91320547
6-[(1S,8aR)-1,2,3,5,6,8a-hexahydroindolizin-1-yl]-1H-indole (PubChem CID 91320547) has the molecular formula C16H18N2 and a molecular weight of 238.33 g/mol. Its IUPAC name is 6-[(1S,8aR)-1,2,3,5,6,8a-hexahydroindolizin-1-yl]-1H-indole.
| Compound Name | 6-[(1S,8aR)-1,2,3,5,6,8a-hexahydroindolizin-1-yl]-1H-indole |
|---|---|
| PubChem CID | 91320547 |
| Molecular Formula | C16H18N2 |
| Molecular Weight | 238.33 g/mol |
| Exact Mass | 238.15 |
| IUPAC Name | 6-[(1S,8aR)-1,2,3,5,6,8a-hexahydroindolizin-1-yl]-1H-indole |
| SMILES | C1=C[C@@H]2[C@H](c3ccc4cc[nH]c4c3)CCN2CC1 |
| InChI | InChI=1S/C16H18N2/c1-2-9-18-10-7-14(16(18)3-1)13-5-4-12-6-8-17-15(12)11-13/h1,3-6,8,11,14,16-17H,2,7,9-10H2/t14-,16+/m0/s1 |
| InChIKey | JOADJVIEZHXNDC-GOEBONIOSA-N |
| XLogP | 3.29 |
| TPSA | 19.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 238.33 |
| LogP ≤ 5 | 3.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|