C30H37ClN4O8 — CID 159915690
1-[4-(3-methoxy-4-nitrophenyl)-3,6-dihydro-2H-pyridin-1-yl]propan-1-one;4-(3-methoxy-4-nitrophenyl)-1,2,3,6-tetrahydropyridine;propanoyl chloride (PubChem CID 159915690) has the molecular formula C30H37ClN4O8 and a molecular weight of 617.10 g/mol. Its IUPAC name is 1-[4-(3-methoxy-4-nitrophenyl)-3,6-dihydro-2H-pyridin-1-yl]propan-1-one;4-(3-methoxy-4-nitrophenyl)-1,2,3,6-tetrahydropyridine;propanoyl chloride.
| Compound Name | 1-[4-(3-methoxy-4-nitrophenyl)-3,6-dihydro-2H-pyridin-1-yl]propan-1-one;4-(3-methoxy-4-nitrophenyl)-1,2,3,6-tetrahydropyridine;propanoyl chloride |
|---|---|
| PubChem CID | 159915690 |
| Molecular Formula | C30H37ClN4O8 |
| Molecular Weight | 617.10 g/mol |
| Exact Mass | 616.23 |
| IUPAC Name | 1-[4-(3-methoxy-4-nitrophenyl)-3,6-dihydro-2H-pyridin-1-yl]propan-1-one;4-(3-methoxy-4-nitrophenyl)-1,2,3,6-tetrahydropyridine;propanoyl chloride |
| SMILES | CCC(=O)Cl.CCC(=O)N1CC=C(c2ccc([N+](=O)[O-])c(OC)c2)CC1.COc1cc(C2=CCNCC2)ccc1[N+](=O)[O-] |
| InChI | InChI=1S/C15H18N2O4.C12H14N2O3.C3H5ClO/c1-3-15(18)16-8-6-11(7-9-16)12-4-5-13(17(19)20)14(10-12)21-2;1-17-12-8-10(2-3-11(12)14(15)16)9-4-6-13-7-5-9;1-2-3(4)5/h4-6,10H,3,7-9H2,1-2H3;2-4,8,13H,5-7H2,1H3;2H2,1H3 |
| InChIKey | NXTDGXCIMYQBGH-UHFFFAOYSA-N |
| XLogP | 5.77 |
| TPSA | 154.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 617.10 |
| LogP ≤ 5 | 5.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'acid_halide', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|