C20H31F5N10O2 — CID 159920611
N-(5-aminopentyl)acetamide;N-[5-[(4,6-difluoro-1,3,5-triazin-2-yl)amino]pentyl]acetamide;2,4,6-trifluoro-1,3,5-triazine (PubChem CID 159920611) has the molecular formula C20H31F5N10O2 and a molecular weight of 538.53 g/mol. Its IUPAC name is N-(5-aminopentyl)acetamide;N-[5-[(4,6-difluoro-1,3,5-triazin-2-yl)amino]pentyl]acetamide;2,4,6-trifluoro-1,3,5-triazine.
| Compound Name | N-(5-aminopentyl)acetamide;N-[5-[(4,6-difluoro-1,3,5-triazin-2-yl)amino]pentyl]acetamide;2,4,6-trifluoro-1,3,5-triazine |
|---|---|
| PubChem CID | 159920611 |
| Molecular Formula | C20H31F5N10O2 |
| Molecular Weight | 538.53 g/mol |
| Exact Mass | 538.26 |
| IUPAC Name | N-(5-aminopentyl)acetamide;N-[5-[(4,6-difluoro-1,3,5-triazin-2-yl)amino]pentyl]acetamide;2,4,6-trifluoro-1,3,5-triazine |
| SMILES | CC(=O)NCCCCCN.CC(=O)NCCCCCNc1nc(F)nc(F)n1.Fc1nc(F)nc(F)n1 |
| InChI | InChI=1S/C10H15F2N5O.C7H16N2O.C3F3N3/c1-7(18)13-5-3-2-4-6-14-10-16-8(11)15-9(12)17-10;1-7(10)9-6-4-2-3-5-8;4-1-7-2(5)9-3(6)8-1/h2-6H2,1H3,(H,13,18)(H,14,15,16,17);2-6,8H2,1H3,(H,9,10); |
| InChIKey | NYIRESLCUQVBTK-UHFFFAOYSA-N |
| XLogP | 1.41 |
| TPSA | 173.59 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 538.53 |
| LogP ≤ 5 | 1.41 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|