C21H16N2 — CID 159932921
5-deuterio-2-methyl-4,7-diphenylquinazoline (PubChem CID 159932921) has the molecular formula C21H16N2 and a molecular weight of 297.38 g/mol. Its IUPAC name is 5-deuterio-2-methyl-4,7-diphenylquinazoline.
| Compound Name | 5-deuterio-2-methyl-4,7-diphenylquinazoline |
|---|---|
| PubChem CID | 159932921 |
| Molecular Formula | C21H16N2 |
| Molecular Weight | 297.38 g/mol |
| Exact Mass | 297.14 |
| IUPAC Name | 5-deuterio-2-methyl-4,7-diphenylquinazoline |
| SMILES | [2H]c1cc(-c2ccccc2)cc2nc(C)nc(-c3ccccc3)c12 |
| InChI | InChI=1S/C21H16N2/c1-15-22-20-14-18(16-8-4-2-5-9-16)12-13-19(20)21(23-15)17-10-6-3-7-11-17/h2-14H,1H3/i13D |
| InChIKey | PHFQMJPNIQYEAF-YSOHJTORSA-N |
| XLogP | 5.27 |
| TPSA | 25.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.38 |
| LogP ≤ 5 | 5.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |