C13H12 — CID 140908815
1,3-dideuterio-2-methyl-5-phenylbenzene (PubChem CID 140908815) has the molecular formula C13H12 and a molecular weight of 170.25 g/mol. Its IUPAC name is 1,3-dideuterio-2-methyl-5-phenylbenzene.
| Compound Name | 1,3-dideuterio-2-methyl-5-phenylbenzene |
|---|---|
| PubChem CID | 140908815 |
| Molecular Formula | C13H12 |
| Molecular Weight | 170.25 g/mol |
| Exact Mass | 170.11 |
| IUPAC Name | 1,3-dideuterio-2-methyl-5-phenylbenzene |
| SMILES | [2H]c1cc(-c2ccccc2)cc([2H])c1C |
| InChI | InChI=1S/C13H12/c1-11-7-9-13(10-8-11)12-5-3-2-4-6-12/h2-10H,1H3/i7D,8D |
| InChIKey | ZZLCFHIKESPLTH-QTQOOCSTSA-N |
| XLogP | 3.66 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 170.25 |
| LogP ≤ 5 | 3.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |