About 1-bromo-2-methylpropane;ethyl 2-acetyl-4-methylpentanoate;ethyl 3-oxobutanoate
1-bromo-2-methylpropane;ethyl 2-acetyl-4-methylpentanoate;ethyl 3-oxobutanoate (PubChem CID 159932968) has the molecular formula C20H37BrO6
and a molecular weight of 453.41 g/mol. Its IUPAC name is 1-bromo-2-methylpropane;ethyl 2-acetyl-4-methylpentanoate;ethyl 3-oxobutanoate.
Molecular Properties
| Compound Name | 1-bromo-2-methylpropane;ethyl 2-acetyl-4-methylpentanoate;ethyl 3-oxobutanoate |
| PubChem CID | 159932968 |
| Molecular Formula | C20H37BrO6 |
| Molecular Weight | 453.41 g/mol |
| Exact Mass | 452.18 |
| IUPAC Name | 1-bromo-2-methylpropane;ethyl 2-acetyl-4-methylpentanoate;ethyl 3-oxobutanoate |
| SMILES | CC(C)CBr.CCOC(=O)C(CC(C)C)C(C)=O.CCOC(=O)CC(C)=O |
| InChI | InChI=1S/C10H18O3.C6H10O3.C4H9Br/c1-5-13-10(12)9(8(4)11)6-7(2)3;1-3-9-6(8)4-5(2)7;1-4(2)3-5/h7,9H,5-6H2,1-4H3;3-4H2,1-2H3;4H,3H2,1-2H3 |
| InChIKey | NZWMINCLROLMKQ-UHFFFAOYSA-N |
| XLogP | 4.37 |
| TPSA | 86.74 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 453.41 |
| LogP ≤ 5 | 4.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|
Analyze 1-bromo-2-methylpropane;ethyl 2-acetyl-4-methylpentanoate;ethyl 3-oxobutanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-bromo-2-methylpropane;ethyl 2-acetyl-4-methylpentanoate;ethyl 3-oxobutanoate?
The IUPAC name of 1-bromo-2-methylpropane;ethyl 2-acetyl-4-methylpentanoate;ethyl 3-oxobutanoate (CID 159932968) is 1-bromo-2-methylpropane;ethyl 2-acetyl-4-methylpentanoate;ethyl 3-oxobutanoate.
What is the SMILES notation for 1-bromo-2-methylpropane;ethyl 2-acetyl-4-methylpentanoate;ethyl 3-oxobutanoate?
The canonical SMILES for 1-bromo-2-methylpropane;ethyl 2-acetyl-4-methylpentanoate;ethyl 3-oxobutanoate is CC(C)CBr.CCOC(=O)C(CC(C)C)C(C)=O.CCOC(=O)CC(C)=O.
What is the InChIKey of 1-bromo-2-methylpropane;ethyl 2-acetyl-4-methylpentanoate;ethyl 3-oxobutanoate?
The InChIKey is NZWMINCLROLMKQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H18O3.C6H10O3.C4H9Br/c1-5-13-10(12)9(8(4)11)6-7(2)3;1-3-9-6(8)4-5(2)7;1-4(2)3-5/h7,9H,5-6H2,1-4H3;3-4H2,1-2H3;4H,3H2,1-2H3.
What are the key properties of 1-bromo-2-methylpropane;ethyl 2-acetyl-4-methylpentanoate;ethyl 3-oxobutanoate?
1-bromo-2-methylpropane;ethyl 2-acetyl-4-methylpentanoate;ethyl 3-oxobutanoate has a molecular weight of 453.41 g/mol, XLogP of 4.37, 9 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 1-bromo-2-methylpropane;ethyl 2-acetyl-4-methylpentanoate;ethyl 3-oxobutanoate is sourced from PubChem (CID 159932968), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).