C30H43N7O6 — CID 159933483
(7-hydroxy-3-methyl-2,4,4a,7,7a,13-hexahydro-1H-4,12-methanobenzofuro[3,2-e]isoquinolin-9-yl) N-[5-[(2-aminoacetyl)amino]-8-(diaminomethylideneamino)-4-oxooctyl]-N-methylcarbamate (PubChem CID 159933483) has the molecular formula C30H43N7O6 and a molecular weight of 597.72 g/mol. Its IUPAC name is (7-hydroxy-3-methyl-2,4,4a,7,7a,13-hexahydro-1H-4,12-methanobenzofuro[3,2-e]isoquinolin-9-yl) N-[5-[(2-aminoacetyl)amino]-8-(diaminomethylideneamino)-4-oxooctyl]-N-methylcarbamate.
| Compound Name | (7-hydroxy-3-methyl-2,4,4a,7,7a,13-hexahydro-1H-4,12-methanobenzofuro[3,2-e]isoquinolin-9-yl) N-[5-[(2-aminoacetyl)amino]-8-(diaminomethylideneamino)-4-oxooctyl]-N-methylcarbamate |
|---|---|
| PubChem CID | 159933483 |
| Molecular Formula | C30H43N7O6 |
| Molecular Weight | 597.72 g/mol |
| Exact Mass | 597.33 |
| IUPAC Name | (7-hydroxy-3-methyl-2,4,4a,7,7a,13-hexahydro-1H-4,12-methanobenzofuro[3,2-e]isoquinolin-9-yl) N-[5-[(2-aminoacetyl)amino]-8-(diaminomethylideneamino)-4-oxooctyl]-N-methylcarbamate |
| SMILES | CN(CCCC(=O)C(CCCN=C(N)N)NC(=O)CN)C(=O)Oc1ccc2c3c1OC1C(O)C=CC4C(C2)N(C)CCC341 |
| InChI | InChI=1S/C30H43N7O6/c1-36-14-11-30-18-8-9-22(39)27(30)43-26-23(10-7-17(25(26)30)15-20(18)36)42-29(41)37(2)13-4-6-21(38)19(35-24(40)16-31)5-3-12-34-28(32)33/h7-10,18-20,22,27,39H,3-6,11-16,31H2,1-2H3,(H,35,40)(H4,32,33,34) |
| InChIKey | NZYBLNNPYNEEMW-UHFFFAOYSA-N |
| XLogP | -0.23 |
| TPSA | 198.83 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 43 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 597.72 |
| LogP ≤ 5 | -0.23 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|