C27H36N4O5 — CID 71666745
[(7S,7aR,12bS)-7-hydroxy-3-methyl-2,4,4a,7,7a,13-hexahydro-1H-4,12-methanobenzofuro[3,2-e]isoquinolin-9-yl] N-methyl-N-[3-oxo-3-(piperidin-1-ylamino)propyl]carbamate (PubChem CID 71666745) has the molecular formula C27H36N4O5 and a molecular weight of 496.61 g/mol. Its IUPAC name is [(7S,7aR,12bS)-7-hydroxy-3-methyl-2,4,4a,7,7a,13-hexahydro-1H-4,12-methanobenzofuro[3,2-e]isoquinolin-9-yl] N-methyl-N-[3-oxo-3-(piperidin-1-ylamino)propyl]carbamate.
| Compound Name | [(7S,7aR,12bS)-7-hydroxy-3-methyl-2,4,4a,7,7a,13-hexahydro-1H-4,12-methanobenzofuro[3,2-e]isoquinolin-9-yl] N-methyl-N-[3-oxo-3-(piperidin-1-ylamino)propyl]carbamate |
|---|---|
| PubChem CID | 71666745 |
| Molecular Formula | C27H36N4O5 |
| Molecular Weight | 496.61 g/mol |
| Exact Mass | 496.27 |
| IUPAC Name | [(7S,7aR,12bS)-7-hydroxy-3-methyl-2,4,4a,7,7a,13-hexahydro-1H-4,12-methanobenzofuro[3,2-e]isoquinolin-9-yl] N-methyl-N-[3-oxo-3-(piperidin-1-ylamino)propyl]carbamate |
| SMILES | CN(CCC(=O)NN1CCCCC1)C(=O)Oc1ccc2c3c1O[C@H]1[C@@H](O)C=CC4C(C2)N(C)CC[C@@]341 |
| InChI | InChI=1S/C27H36N4O5/c1-29-15-11-27-18-7-8-20(32)25(27)36-24-21(9-6-17(23(24)27)16-19(18)29)35-26(34)30(2)14-10-22(33)28-31-12-4-3-5-13-31/h6-9,18-20,25,32H,3-5,10-16H2,1-2H3,(H,28,33)/t18?,19?,20-,25-,27-/m0/s1 |
| InChIKey | MMZJMXIDOYEUNH-JBENVTRGSA-N |
| XLogP | 1.83 |
| TPSA | 94.58 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 496.61 |
| LogP ≤ 5 | 1.83 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|